Cart (0)
No products in the cart.
Purchase CAS:93107-30-3 | 1-Cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic Acid,view related peer-reviewed papers,technical documents,similar products,MSDS & more.Synthesis AnalysisThe synthesis of related quinolone derivatives involves multiple steps, including acyl-chlorination, condensation, decarboxylation, esterification, cyclopropylamine replacement, and cyclization processes. For instance, Liu Zhe reported the preparation of a closely related compound,...
The synthesis of related quinolone derivatives involves multiple steps, including acyl-chlorination, condensation, decarboxylation, esterification, cyclopropylamine replacement, and cyclization processes. For instance, Liu Zhe reported the preparation of a closely related compound, 1-cyclopropyl-6,7-difluoro-8-methyl-1,4-dihydro-4-oxoquinoline-3-ethyl carboxylate, with an overall yield of 48% starting from 3-methoxyl-2,4,5-trifluorobenzoic acid (Liu Zhe, 2001).
Molecular structure analyses, including infrared spectra and Fourier-transform ion cyclotron resonance spectrometry (FT-ICR-MS), provide insights into the characteristic fragment ions and the structural confirmation of quinolone derivatives. Zhiwei Lin conducted a study focusing on a similar quinolone derivative, highlighting the utility of these techniques in understanding the molecular structure (Lin, 2014).
Quinolone derivatives undergo various chemical reactions, including displacement reactions with amine nucleophiles, which occur regioselectively at specific positions depending on the substrate and solvent. Shibamori et al. demonstrated this regioselectivity in the synthesis of quinolone derivatives, allowing for the introduction of different nucleophiles at desired positions (Shibamori et al., 1990).
The study of physical properties such as melting and dissociation characteristics is essential for understanding the behavior of quinolone derivatives in various conditions. Yin Qiuxiang investigated these properties for a related compound, providing valuable data for the crystallization and purification processes in the industrial manufacture of quinolone antibiotics (Yin Qiuxiang, 2002).
The chemical properties of quinolone derivatives, including their reactivity and interaction with other molecules, are crucial for their potential applications. Photochemistry studies, for example, reveal how these compounds behave under irradiation, which is pertinent for their stability and efficacy. M. Mella, E. Fasani, and A. Albini explored the photochemical behavior of ciprofloxacin, a well-known quinolone derivative, in aqueous solutions, providing insights into its photostability and reaction mechanisms (Mella, Fasani, & Albini, 2001).
This compound is suspected of damaging fertility or the unborn child and is harmful to aquatic life with long-lasting effects. It is advised to avoid breathing mist, gas, or vapors, and to avoid contact with skin and eyes. Use of personal protective equipment, including chemical impermeable gloves, is recommended.
| Product Name: | 1-Cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic Acid |
| Synonyms: | 1-CYCLOPROPYL-6,7-DIFLUORO-1,4-DIHYDRO-4-OXOQUINOLINE-3-CARBOXYLIC ACID;6,7-DIFLUORO-4-OXO-1-CYCLOPROPYL-1,4-DIHYDRO-QUINOLINE-3-CARBOXYLIC ACID;1-Cyclopropyl-6,7-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid;1-CYCLOPROPYL-6,7-DIFLUORO-4-OXOQUINOLINE-3-CARBOXYLIC ACID;3-Quinolinecarboxylic acid, 1-cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxo-;Ciprofloxacin Intermediate;Moxifloxacin Difluoro Acid Impurity;1-Cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic Acid > |
| CAS: | 93107-30-3 |
| MF: | C13H9F2NO3 |
| MW: | 265.21 |
| EINECS: | 413-760-7 |
| Product Categories: | |
| Mol File: | 93107-30-3.mol |
| 1-Cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic Acid Chemical Properties |
| Melting point | 289°C(lit.) |
| Boiling point | 434.2±45.0 °C(Predicted) |
| density | 1.630±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO |
| form | Solid |
| pka | 6.36±0.41(Predicted) |
| color | Off-White |
| InChI | InChI=1S/C13H9F2NO3/c14-9-3-7-11(4-10(9)15)16(6-1-2-6)5-8(12(7)17)13(18)19/h3-6H,1-2H2,(H,18,19) |
| InChIKey | KNEXGVPHPGXAGF-UHFFFAOYSA-N |
| SMILES | N1(C2CC2)C2=C(C=C(F)C(F)=C2)C(=O)C(C(O)=O)=C1 |