Cart (0)
No products in the cart.
Purchase CAS:202865-57-4 | 1-BROMO-2,5-DICHLORO-3-FLUOROBENZENE,view related peer-reviewed papers,technical documents,similar products,MSDS & more.1-Bromo-2,5-dichloro-3-fluorobenzene is a halogenated benzene derivative with bromine, chlorine, and fluorine substituents. This compound is of interest in various fields of chemistry due to its unique molecular structure, which imparts distinct chemical and physical properties....
1-Bromo-2,5-dichloro-3-fluorobenzene is a halogenated benzene derivative with bromine, chlorine, and fluorine substituents. This compound is of interest in various fields of chemistry due to its unique molecular structure, which imparts distinct chemical and physical properties.
The synthesis of halogenated benzene derivatives, including 1-Bromo-2,5-dichloro-3-fluorobenzene, involves multiple steps, such as diazotization, bromination, and chlorination. These processes are crucial for introducing different halogen atoms at specific positions on the benzene ring. For instance, the synthesis of 1,2-bis(bromomethyl)-4-fluorobenzene, a related compound, demonstrates the use of bromine in radical bromination reactions, highlighting the synthetic approaches applicable to halogenated benzenes (Guo Zhi-an, 2009).
The molecular structure of halogenated benzenes, including 1-Bromo-2,5-dichloro-3-fluorobenzene, has been extensively studied using spectroscopic methods. Techniques such as FT-IR, FT-Raman, and UV spectroscopy, combined with DFT calculations, provide insights into the vibrational frequencies, molecular geometry, and electronic properties of these compounds. The presence of halogen atoms significantly affects the molecular geometry and electronic distribution within the molecule (D. Mahadevan et al., 2011).
Halogenated benzene derivatives undergo various chemical reactions, including nucleophilic substitution, due to the presence of halogen atoms. These reactions are pivotal for further chemical modifications and the synthesis of complex organic molecules. For example, electrochemical fluorination and palladium-catalyzed carbonylative reactions demonstrate the reactivity of halogenated benzenes under different conditions, leading to the formation of fluorinated compounds and heterocycles, respectively (Hirohide Horio et al., 1996); (Jianbin Chen et al., 2014).
1-Bromo-2,5-dichloro-3-fluorobenzene may cause skin irritation, serious eye irritation, and respiratory irritation. It is recommended to avoid breathing dust/fume/gas/mist/vapors/spray and to wear protective gloves/protective clothing/eye protection/face protection.
| Product Name: | 1-BROMO-2,5-DICHLORO-3-FLUOROBENZENE |
| Synonyms: | 1-BROMO-2,5-DICHLORO-3-FLUOROBENZENE;1-Bromo-2,5-dichloro-3-fluorobenzene 98%;1-Bromo-2,5-dichloro-3-fluorobenzene98%;1-BroMo-2,5-dichloro-3-fluorobenzene;2,5-Dichloro-3-fluorobromobenzene;3-Bromo-2,5-dichloro-1-fluorobenzene;Benzene, 1-bromo-2,5-dichloro-3-fluoro-;2,5-dichloro-3-fluoro-1-bromobenzene |
| CAS: | 202865-57-4 |
| MF: | C6H2BrCl2F |
| MW: | 243.89 |
| EINECS: | 606-489-2 |
| Product Categories: | Bromine Compounds;Chlorine Compounds;Fluorine Compounds;Fluorine series |
| Mol File: | 202865-57-4.mol |
| 1-BROMO-2,5-DICHLORO-3-FLUOROBENZENE Chemical Properties |
| Boiling point | 232℃ |
| density | 1.823 |
| refractive index | 1.5745-1.5765 |
| Fp | 94℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear, colourless |
| InChI | InChI=1S/C6H2BrCl2F/c7-4-1-3(8)2-5(10)6(4)9/h1-2H |
| InChIKey | CAYJMDVKWMVOLG-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(Cl)=CC(F)=C1Cl |
| CAS DataBase Reference | 202865-57-4(CAS DataBase Reference) |